C18H21N5O4S — CID 55346400
2-methyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 55346400) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2-methyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55346400 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-methyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NCC(=O)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H21N5O4S/c1-12-4-2-3-5-13(12)16(25)19-10-15(24)21-22-17(26)14-11-28-18(20-14)23-6-8-27-9-7-23/h2-5,11H,6-10H2,1H3,(H,19,25)(H,21,24)(H,22,26) |
| InChIKey | PEVKNUXSYXRLMS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|