C21H27N5O4S — CID 31718296
4-tert-butyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 31718296) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 31718296 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-tert-butyl-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)NNC(=O)c2csc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H27N5O4S/c1-21(2,3)15-6-4-14(5-7-15)18(28)22-12-17(27)24-25-19(29)16-13-31-20(23-16)26-8-10-30-11-9-26/h4-7,13H,8-12H2,1-3H3,(H,22,28)(H,24,27)(H,25,29) |
| InChIKey | RFEZKKNHFOKZLZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|