C17H25N5O4S — CID 18120613
N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 18120613) has the molecular formula C17H25N5O4S and a molecular weight of 395.49 g/mol. Its IUPAC name is N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18120613 |
| Molecular Formula | C17H25N5O4S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCCC1)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H25N5O4S/c23-14(10-18-15(24)12-4-2-1-3-5-12)20-21-16(25)13-11-27-17(19-13)22-6-8-26-9-7-22/h11-12H,1-10H2,(H,18,24)(H,20,23)(H,21,25) |
| InChIKey | PQNGTIXHLOPNKK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|