C17H17Cl2N5O4S — CID 24553645
2,4-dichloro-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 24553645) has the molecular formula C17H17Cl2N5O4S and a molecular weight of 458.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24553645 |
| Molecular Formula | C17H17Cl2N5O4S |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 2,4-dichloro-N-[2-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1Cl)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H17Cl2N5O4S/c18-10-1-2-11(12(19)7-10)15(26)20-8-14(25)22-23-16(27)13-9-29-17(21-13)24-3-5-28-6-4-24/h1-2,7,9H,3-6,8H2,(H,20,26)(H,22,25)(H,23,27) |
| InChIKey | NHTJOOFHGJPWCK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|