C18H17ClN6O3S — CID 16599836
N'-[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 16599836) has the molecular formula C18H17ClN6O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is N'-[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 16599836 |
| Molecular Formula | C18H17ClN6O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N'-[5-(4-chlorophenyl)-1H-pyrazole-4-carbonyl]-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cn[nH]c1-c1ccc(Cl)cc1)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H17ClN6O3S/c19-12-3-1-11(2-4-12)15-13(9-20-22-15)16(26)23-24-17(27)14-10-29-18(21-14)25-5-7-28-8-6-25/h1-4,9-10H,5-8H2,(H,20,22)(H,23,26)(H,24,27) |
| InChIKey | HHMPWJYVKJUVFO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|