C16H15F3N4O3S2 — CID 55616625
2-morpholin-4-yl-N'-[2-(trifluoromethylsulfanyl)benzoyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 55616625) has the molecular formula C16H15F3N4O3S2 and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-morpholin-4-yl-N'-[2-(trifluoromethylsulfanyl)benzoyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-morpholin-4-yl-N'-[2-(trifluoromethylsulfanyl)benzoyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55616625 |
| Molecular Formula | C16H15F3N4O3S2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-morpholin-4-yl-N'-[2-(trifluoromethylsulfanyl)benzoyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1SC(F)(F)F)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H15F3N4O3S2/c17-16(18,19)28-12-4-2-1-3-10(12)13(24)21-22-14(25)11-9-27-15(20-11)23-5-7-26-8-6-23/h1-4,9H,5-8H2,(H,21,24)(H,22,25) |
| InChIKey | WRMCXBVEMGPRPH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|