C18H17F3N4O3S2 — CID 30087335
2-morpholin-4-yl-N'-[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 30087335) has the molecular formula C18H17F3N4O3S2 and a molecular weight of 458.49 g/mol. Its IUPAC name is 2-morpholin-4-yl-N'-[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-morpholin-4-yl-N'-[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 30087335 |
| Molecular Formula | C18H17F3N4O3S2 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 2-morpholin-4-yl-N'-[(E)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enoyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(/C=C/c1ccc(SC(F)(F)F)cc1)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H17F3N4O3S2/c19-18(20,21)30-13-4-1-12(2-5-13)3-6-15(26)23-24-16(27)14-11-29-17(22-14)25-7-9-28-10-8-25/h1-6,11H,7-10H2,(H,23,26)(H,24,27)/b6-3+ |
| InChIKey | HEVHVIDPTIZSHT-ZZXKWVIFSA-N |
| XLogP | 3.07 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|