C16H17FN4O3S — CID 31718405
N'-(3-fluoro-4-methylbenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 31718405) has the molecular formula C16H17FN4O3S and a molecular weight of 364.40 g/mol. Its IUPAC name is N'-(3-fluoro-4-methylbenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(3-fluoro-4-methylbenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 31718405 |
| Molecular Formula | C16H17FN4O3S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N'-(3-fluoro-4-methylbenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2csc(N3CCOCC3)n2)cc1F |
| InChI | InChI=1S/C16H17FN4O3S/c1-10-2-3-11(8-12(10)17)14(22)19-20-15(23)13-9-25-16(18-13)21-4-6-24-7-5-21/h2-3,8-9H,4-7H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | WZLWCLYASBGXGF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|