C16H18N4O6S2 — CID 55353253
2-methyl-5-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]sulfamoyl]benzoic acid (PubChem CID 55353253) has the molecular formula C16H18N4O6S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-methyl-5-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]sulfamoyl]benzoic acid.
| Compound Name | 2-methyl-5-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 55353253 |
| Molecular Formula | C16H18N4O6S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-methyl-5-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)c2csc(N3CCOCC3)n2)cc1C(=O)O |
| InChI | InChI=1S/C16H18N4O6S2/c1-10-2-3-11(8-12(10)15(22)23)28(24,25)19-18-14(21)13-9-27-16(17-13)20-4-6-26-7-5-20/h2-3,8-9,19H,4-7H2,1H3,(H,18,21)(H,22,23) |
| InChIKey | LMHHRHWMMAYKEJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|