C16H20N4O4S2 — CID 8505665
N'-(4-methylphenyl)sulfonyl-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 8505665) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 8505665 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)Cc2csc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C16H20N4O4S2/c1-12-2-4-14(5-3-12)26(22,23)19-18-15(21)10-13-11-25-16(17-13)20-6-8-24-9-7-20/h2-5,11,19H,6-10H2,1H3,(H,18,21) |
| InChIKey | ZKLJXSRJCQTNGP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|