C17H21N5O2S2 — CID 8627730
1-benzyl-3-[[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]amino]thiourea (PubChem CID 8627730) has the molecular formula C17H21N5O2S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-benzyl-3-[[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8627730 |
| Molecular Formula | C17H21N5O2S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-benzyl-3-[[2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetyl]amino]thiourea |
| SMILES | O=C(Cc1csc(N2CCOCC2)n1)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C17H21N5O2S2/c23-15(20-21-16(25)18-11-13-4-2-1-3-5-13)10-14-12-26-17(19-14)22-6-8-24-9-7-22/h1-5,12H,6-11H2,(H,20,23)(H2,18,21,25) |
| InChIKey | DWKKLZWVECTMTJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|