C18H19N3O3S — CID 18271886
1-benzyl-3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]amino]thiourea (PubChem CID 18271886) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-benzyl-3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 18271886 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-benzyl-3-[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl]amino]thiourea |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C18H19N3O3S/c22-17(11-14-6-7-15-16(10-14)24-9-8-23-15)20-21-18(25)19-12-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,20,22)(H2,19,21,25) |
| InChIKey | DPRJCUKLYRUXNP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|