C18H16N4O4S — CID 18282065
1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]thiourea (PubChem CID 18282065) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 18282065 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]thiourea |
| SMILES | O=C(Cc1noc2ccccc12)NNC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16N4O4S/c23-17(8-13-12-3-1-2-4-14(12)26-22-13)20-21-18(27)19-9-11-5-6-15-16(7-11)25-10-24-15/h1-7H,8-10H2,(H,20,23)(H2,19,21,27) |
| InChIKey | ISYJAZHQJWMIIP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|