C20H19N3O5S — CID 24637418
1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]amino]thiourea (PubChem CID 24637418) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]amino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 24637418 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(6-methoxy-1-benzofuran-3-yl)acetyl]amino]thiourea |
| SMILES | COc1ccc2c(CC(=O)NNC(=S)NCc3ccc4c(c3)OCO4)coc2c1 |
| InChI | InChI=1S/C20H19N3O5S/c1-25-14-3-4-15-13(10-26-17(15)8-14)7-19(24)22-23-20(29)21-9-12-2-5-16-18(6-12)28-11-27-16/h2-6,8,10H,7,9,11H2,1H3,(H,22,24)(H2,21,23,29) |
| InChIKey | FSDUVRVTCRGIMM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|