C20H20N4O5S — CID 24637381
1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea (PubChem CID 24637381) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea |
|---|---|
| PubChem CID | 24637381 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)NNC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20N4O5S/c25-18(6-3-9-24-14-4-1-2-5-15(14)29-20(24)26)22-23-19(30)21-11-13-7-8-16-17(10-13)28-12-27-16/h1-2,4-5,7-8,10H,3,6,9,11-12H2,(H,22,25)(H2,21,23,30) |
| InChIKey | PPRIRWYLWUMKKV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|