C15H20N4O3S — CID 9426017
1-tert-butyl-3-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]thiourea (PubChem CID 9426017) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]thiourea.
| Compound Name | 1-tert-butyl-3-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 9426017 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-tert-butyl-3-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoylamino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C15H20N4O3S/c1-15(2,3)16-13(23)18-17-12(20)8-9-19-10-6-4-5-7-11(10)22-14(19)21/h4-7H,8-9H2,1-3H3,(H,17,20)(H2,16,18,23) |
| InChIKey | HUNHEKYPAMVOPH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|