C18H17FN4O3S — CID 9468603
1-(2-fluorophenyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea (PubChem CID 9468603) has the molecular formula C18H17FN4O3S and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea |
|---|---|
| PubChem CID | 9468603 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[4-(2-oxo-1,3-benzoxazol-3-yl)butanoylamino]thiourea |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C18H17FN4O3S/c19-12-6-1-2-7-13(12)20-17(27)22-21-16(24)10-5-11-23-14-8-3-4-9-15(14)26-18(23)25/h1-4,6-9H,5,10-11H2,(H,21,24)(H2,20,22,27) |
| InChIKey | VWYQOSGMRMFHTF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|