About N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide
N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide (PubChem CID 18121118) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide.
Molecular Properties
| Compound Name | N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide |
| PubChem CID | 18121118 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide |
| SMILES | CN(NC(=O)CCCn1c(=O)oc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C18H19N3O3/c1-20(14-8-3-2-4-9-14)19-17(22)12-7-13-21-15-10-5-6-11-16(15)24-18(21)23/h2-6,8-11H,7,12-13H2,1H3,(H,19,22) |
| InChIKey | KKIPHGFQYXUPQZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide?
The IUPAC name of N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide (CID 18121118) is N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide.
What is the SMILES notation for N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide?
The canonical SMILES for N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide is CN(NC(=O)CCCn1c(=O)oc2ccccc21)c1ccccc1.
What is the InChIKey of N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide?
The InChIKey is KKIPHGFQYXUPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3/c1-20(14-8-3-2-4-9-14)19-17(22)12-7-13-21-15-10-5-6-11-16(15)24-18(21)23/h2-6,8-11H,7,12-13H2,1H3,(H,19,22).
What are the key properties of N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide?
N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide has a molecular weight of 325.37 g/mol, XLogP of 2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-4-(2-oxo-1,3-benzoxazol-3-yl)-N'-phenylbutanehydrazide is sourced from PubChem (CID 18121118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).