C13H15NO3 — CID 106801664
3-(4-oxohexyl)-1,3-benzoxazol-2-one (PubChem CID 106801664) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(4-oxohexyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-(4-oxohexyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 106801664 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-(4-oxohexyl)-1,3-benzoxazol-2-one |
| SMILES | CCC(=O)CCCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C13H15NO3/c1-2-10(15)6-5-9-14-11-7-3-4-8-12(11)17-13(14)16/h3-4,7-8H,2,5-6,9H2,1H3 |
| InChIKey | MKSZJHHSYZYALW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |