C12H14BrNO2 — CID 24806895
3-(5-bromopentyl)-1,3-benzoxazol-2-one (PubChem CID 24806895) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 3-(5-bromopentyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-(5-bromopentyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 24806895 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 3-(5-bromopentyl)-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CCCCCBr |
| InChI | InChI=1S/C12H14BrNO2/c13-8-4-1-5-9-14-10-6-2-3-7-11(10)16-12(14)15/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | SXTODGFBPKMVDQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|