C15H20N2O2 — CID 55087544
3-[3-(cyclopentylamino)propyl]-1,3-benzoxazol-2-one (PubChem CID 55087544) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[3-(cyclopentylamino)propyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[3-(cyclopentylamino)propyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 55087544 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-[3-(cyclopentylamino)propyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CCCNC1CCCC1 |
| InChI | InChI=1S/C15H20N2O2/c18-15-17(13-8-3-4-9-14(13)19-15)11-5-10-16-12-6-1-2-7-12/h3-4,8-9,12,16H,1-2,5-7,10-11H2 |
| InChIKey | MDAHZBVOZJVADB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|