C25H30N4O4 — CID 58511876
3-[5-[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one (PubChem CID 58511876) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[5-[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[5-[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 58511876 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-[5-[4-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CCCCCN1CCN(CCn2c(=O)oc3ccccc32)CC1 |
| InChI | InChI=1S/C25H30N4O4/c30-24-28(20-8-2-4-10-22(20)32-24)13-7-1-6-12-26-14-16-27(17-15-26)18-19-29-21-9-3-5-11-23(21)33-25(29)31/h2-5,8-11H,1,6-7,12-19H2 |
| InChIKey | GDUWSBUTXRBOKH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|