C21H25N3O3 — CID 122367613
3-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one (PubChem CID 122367613) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 122367613 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]butyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CCCCN1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C21H25N3O3/c25-18-9-7-17(8-10-18)23-15-13-22(14-16-23)11-3-4-12-24-19-5-1-2-6-20(19)27-21(24)26/h1-2,5-10,25H,3-4,11-16H2 |
| InChIKey | ZYKJWKWHCYZEAE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|