C25H33Cl2N3O2 — CID 157312560
3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-6-prop-1-en-2-yl-1,3-benzoxazol-2-one;dihydrochloride (PubChem CID 157312560) has the molecular formula C25H33Cl2N3O2 and a molecular weight of 478.46 g/mol. Its IUPAC name is 3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-6-prop-1-en-2-yl-1,3-benzoxazol-2-one;dihydrochloride.
| Compound Name | 3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-6-prop-1-en-2-yl-1,3-benzoxazol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 157312560 |
| Molecular Formula | C25H33Cl2N3O2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-[4-[4-(4-methylphenyl)piperazin-1-yl]butyl]-6-prop-1-en-2-yl-1,3-benzoxazol-2-one;dihydrochloride |
| SMILES | C=C(C)c1ccc2c(c1)oc(=O)n2CCCCN1CCN(c2ccc(C)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C25H31N3O2.2ClH/c1-19(2)21-8-11-23-24(18-21)30-25(29)28(23)13-5-4-12-26-14-16-27(17-15-26)22-9-6-20(3)7-10-22;;/h6-11,18H,1,4-5,12-17H2,2-3H3;2*1H |
| InChIKey | PDRSCVOMLWTTOG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|