C24H27N3O3 — CID 143767707
6-acetyl-3-[(E)-4-[4-(4-methylphenyl)piperazin-1-yl]but-2-enyl]-1,3-benzoxazol-2-one (PubChem CID 143767707) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 6-acetyl-3-[(E)-4-[4-(4-methylphenyl)piperazin-1-yl]but-2-enyl]-1,3-benzoxazol-2-one.
| Compound Name | 6-acetyl-3-[(E)-4-[4-(4-methylphenyl)piperazin-1-yl]but-2-enyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 143767707 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 6-acetyl-3-[(E)-4-[4-(4-methylphenyl)piperazin-1-yl]but-2-enyl]-1,3-benzoxazol-2-one |
| SMILES | CC(=O)c1ccc2c(c1)oc(=O)n2C/C=C/CN1CCN(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C24H27N3O3/c1-18-5-8-21(9-6-18)26-15-13-25(14-16-26)11-3-4-12-27-22-10-7-20(19(2)28)17-23(22)30-24(27)29/h3-10,17H,11-16H2,1-2H3/b4-3+ |
| InChIKey | ABIPKKIIFKDCMA-ONEGZZNKSA-N |
| XLogP | 3.48 |
| TPSA | 58.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|