C11H11NO2 — CID 73054095
6-methyl-3-prop-2-enyl-1,3-benzoxazol-2-one (PubChem CID 73054095) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 6-methyl-3-prop-2-enyl-1,3-benzoxazol-2-one.
| Compound Name | 6-methyl-3-prop-2-enyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 73054095 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 6-methyl-3-prop-2-enyl-1,3-benzoxazol-2-one |
| SMILES | C=CCn1c(=O)oc2cc(C)ccc21 |
| InChI | InChI=1S/C11H11NO2/c1-3-6-12-9-5-4-8(2)7-10(9)14-11(12)13/h3-5,7H,1,6H2,2H3 |
| InChIKey | HOFWXRHVVLPPBO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|