About 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea
1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea (PubChem CID 50797234) has the molecular formula C18H16FN3O3
and a molecular weight of 341.34 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea.
Molecular Properties
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea |
| PubChem CID | 50797234 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea |
| SMILES | C=CCn1c(=O)oc2cc(NC(=O)Nc3ccc(C)c(F)c3)ccc21 |
| InChI | InChI=1S/C18H16FN3O3/c1-3-8-22-15-7-6-13(10-16(15)25-18(22)24)21-17(23)20-12-5-4-11(2)14(19)9-12/h3-7,9-10H,1,8H2,2H3,(H2,20,21,23) |
| InChIKey | MZEYHZYZSAFONQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea?
The IUPAC name of 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea (CID 50797234) is 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea.
What is the SMILES notation for 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea?
The canonical SMILES for 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea is C=CCn1c(=O)oc2cc(NC(=O)Nc3ccc(C)c(F)c3)ccc21.
What is the InChIKey of 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea?
The InChIKey is MZEYHZYZSAFONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O3/c1-3-8-22-15-7-6-13(10-16(15)25-18(22)24)21-17(23)20-12-5-4-11(2)14(19)9-12/h3-7,9-10H,1,8H2,2H3,(H2,20,21,23).
What are the key properties of 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea?
1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea has a molecular weight of 341.34 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoro-4-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea is sourced from PubChem (CID 50797234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).