C19H19N3O5 — CID 50797317
1-(3,4-dimethoxyphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea (PubChem CID 50797317) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 50797317 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea |
| SMILES | C=CCn1c(=O)oc2cc(NC(=O)Nc3ccc(OC)c(OC)c3)ccc21 |
| InChI | InChI=1S/C19H19N3O5/c1-4-9-22-14-7-5-12(10-16(14)27-19(22)24)20-18(23)21-13-6-8-15(25-2)17(11-13)26-3/h4-8,10-11H,1,9H2,2-3H3,(H2,20,21,23) |
| InChIKey | DXJVMAXNBYXHJG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|