C18H16ClN3O3 — CID 50797153
1-(5-chloro-2-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea (PubChem CID 50797153) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea |
|---|---|
| PubChem CID | 50797153 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-(2-oxo-3-prop-2-enyl-1,3-benzoxazol-6-yl)urea |
| SMILES | C=CCn1c(=O)oc2cc(NC(=O)Nc3cc(Cl)ccc3C)ccc21 |
| InChI | InChI=1S/C18H16ClN3O3/c1-3-8-22-15-7-6-13(10-16(15)25-18(22)24)20-17(23)21-14-9-12(19)5-4-11(14)2/h3-7,9-10H,1,8H2,2H3,(H2,20,21,23) |
| InChIKey | YNHKWPRMWZEKBF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|