C19H18N2O5 — CID 53084910
N-(3,4-dimethoxyphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide (PubChem CID 53084910) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 53084910 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-oxo-3-prop-2-enyl-1,3-benzoxazole-5-carboxamide |
| SMILES | C=CCn1c(=O)oc2ccc(C(=O)Nc3ccc(OC)c(OC)c3)cc21 |
| InChI | InChI=1S/C19H18N2O5/c1-4-9-21-14-10-12(5-7-15(14)26-19(21)23)18(22)20-13-6-8-16(24-2)17(11-13)25-3/h4-8,10-11H,1,9H2,2-3H3,(H,20,22) |
| InChIKey | OOKNMPGDHJSYLE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|