C17H19N3O3 — CID 109224281
N-(3,4-dimethoxyphenyl)-5-(prop-2-enylamino)pyridine-3-carboxamide (PubChem CID 109224281) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-(prop-2-enylamino)pyridine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-(prop-2-enylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109224281 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-(prop-2-enylamino)pyridine-3-carboxamide |
| SMILES | C=CCNc1cncc(C(=O)Nc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-4-7-19-14-8-12(10-18-11-14)17(21)20-13-5-6-15(22-2)16(9-13)23-3/h4-6,8-11,19H,1,7H2,2-3H3,(H,20,21) |
| InChIKey | FVURLZZJYHPROH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|