C16H13ClF3N3O — CID 109224318
N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(prop-2-enylamino)pyridine-3-carboxamide (PubChem CID 109224318) has the molecular formula C16H13ClF3N3O and a molecular weight of 355.75 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(prop-2-enylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(prop-2-enylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109224318 |
| Molecular Formula | C16H13ClF3N3O |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-(prop-2-enylamino)pyridine-3-carboxamide |
| SMILES | C=CCNc1cncc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H13ClF3N3O/c1-2-5-22-12-6-10(8-21-9-12)15(24)23-11-3-4-14(17)13(7-11)16(18,19)20/h2-4,6-9,22H,1,5H2,(H,23,24) |
| InChIKey | SOHMFPKPCYAWNC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|