C12H16N2O3 — CID 17277594
1-(3,4-dimethoxyphenyl)-3-prop-2-enylurea (PubChem CID 17277594) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-prop-2-enylurea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 17277594 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H16N2O3/c1-4-7-13-12(15)14-9-5-6-10(16-2)11(8-9)17-3/h4-6,8H,1,7H2,2-3H3,(H2,13,14,15) |
| InChIKey | HEDBBSPLWGRGLP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|