C10H12N2O2 — CID 67731511
1-(4-hydroxyphenyl)-3-prop-2-enylurea (PubChem CID 67731511) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-prop-2-enylurea.
| Compound Name | 1-(4-hydroxyphenyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 67731511 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12N2O2/c1-2-7-11-10(14)12-8-3-5-9(13)6-4-8/h2-6,13H,1,7H2,(H2,11,12,14) |
| InChIKey | XQUHTWBUNJPJAM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|