C14H21ClN4O2 — CID 119278037
4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride (PubChem CID 119278037) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119278037 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]butanamide;hydrochloride |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)CCCN)cc1.Cl |
| InChI | InChI=1S/C14H20N4O2.ClH/c1-2-10-16-14(20)18-12-7-5-11(6-8-12)17-13(19)4-3-9-15;/h2,5-8H,1,3-4,9-10,15H2,(H,17,19)(H2,16,18,20);1H |
| InChIKey | OZLYYIMHQBFGJY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|