C15H23ClN4O2 — CID 120559670
4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]pentanamide;hydrochloride (PubChem CID 120559670) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120559670 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-amino-N-[4-(prop-2-enylcarbamoylamino)phenyl]pentanamide;hydrochloride |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)CCC(C)N)cc1.Cl |
| InChI | InChI=1S/C15H22N4O2.ClH/c1-3-10-17-15(21)19-13-7-5-12(6-8-13)18-14(20)9-4-11(2)16;/h3,5-8,11H,1,4,9-10,16H2,2H3,(H,18,20)(H2,17,19,21);1H |
| InChIKey | ABFDLPKLCHSOIR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|