C13H20N4O2 — CID 82848160
5-amino-N-[4-(carbamoylamino)phenyl]hexanamide (PubChem CID 82848160) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-amino-N-[4-(carbamoylamino)phenyl]hexanamide.
| Compound Name | 5-amino-N-[4-(carbamoylamino)phenyl]hexanamide |
|---|---|
| PubChem CID | 82848160 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-amino-N-[4-(carbamoylamino)phenyl]hexanamide |
| SMILES | CC(N)CCCC(=O)Nc1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C13H20N4O2/c1-9(14)3-2-4-12(18)16-10-5-7-11(8-6-10)17-13(15)19/h5-9H,2-4,14H2,1H3,(H,16,18)(H3,15,17,19) |
| InChIKey | VHWPUMSSRLYJHZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |