C16H25N3O2 — CID 82849341
4-(5-aminohexanoylamino)-N-propan-2-ylbenzamide (PubChem CID 82849341) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-(5-aminohexanoylamino)-N-propan-2-ylbenzamide.
| Compound Name | 4-(5-aminohexanoylamino)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 82849341 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-(5-aminohexanoylamino)-N-propan-2-ylbenzamide |
| SMILES | CC(N)CCCC(=O)Nc1ccc(C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-11(2)18-16(21)13-7-9-14(10-8-13)19-15(20)6-4-5-12(3)17/h7-12H,4-6,17H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | XNGWLGWCPCZSDF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |