C32H46N4O4 — CID 17201350
N,N'-bis[4-(butan-2-ylcarbamoyl)phenyl]decanediamide (PubChem CID 17201350) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is N,N'-bis[4-(butan-2-ylcarbamoyl)phenyl]decanediamide.
| Compound Name | N,N'-bis[4-(butan-2-ylcarbamoyl)phenyl]decanediamide |
|---|---|
| PubChem CID | 17201350 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | N,N'-bis[4-(butan-2-ylcarbamoyl)phenyl]decanediamide |
| SMILES | CCC(C)NC(=O)c1ccc(NC(=O)CCCCCCCCC(=O)Nc2ccc(C(=O)NC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C32H46N4O4/c1-5-23(3)33-31(39)25-15-19-27(20-16-25)35-29(37)13-11-9-7-8-10-12-14-30(38)36-28-21-17-26(18-22-28)32(40)34-24(4)6-2/h15-24H,5-14H2,1-4H3,(H,33,39)(H,34,40)(H,35,37)(H,36,38) |
| InChIKey | RDYWTZSVGRUUHA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|