C25H34N4O3 — CID 54836855
N-butan-2-yl-4-[[2-[3-(hexanoylamino)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54836855) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-butan-2-yl-4-[[2-[3-(hexanoylamino)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-butan-2-yl-4-[[2-[3-(hexanoylamino)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54836855 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-butan-2-yl-4-[[2-[3-(hexanoylamino)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)CNc2ccc(C(=O)NC(C)CC)cc2)c1 |
| InChI | InChI=1S/C25H34N4O3/c1-4-6-7-11-23(30)28-21-9-8-10-22(16-21)29-24(31)17-26-20-14-12-19(13-15-20)25(32)27-18(3)5-2/h8-10,12-16,18,26H,4-7,11,17H2,1-3H3,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | TZNIQZNWTDRRIQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|