C11H17ClN4O2 — CID 119701459
3-amino-N-[4-(carbamoylamino)phenyl]butanamide;hydrochloride (PubChem CID 119701459) has the molecular formula C11H17ClN4O2 and a molecular weight of 272.74 g/mol. Its IUPAC name is 3-amino-N-[4-(carbamoylamino)phenyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[4-(carbamoylamino)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119701459 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-amino-N-[4-(carbamoylamino)phenyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)Nc1ccc(NC(N)=O)cc1.Cl |
| InChI | InChI=1S/C11H16N4O2.ClH/c1-7(12)6-10(16)14-8-2-4-9(5-3-8)15-11(13)17;/h2-5,7H,6,12H2,1H3,(H,14,16)(H3,13,15,17);1H |
| InChIKey | MRVAMTNDKYDCRU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |