C11H18ClN3O3S — CID 119701893
3-amino-N-[4-(sulfamoylmethyl)phenyl]butanamide;hydrochloride (PubChem CID 119701893) has the molecular formula C11H18ClN3O3S and a molecular weight of 307.80 g/mol. Its IUPAC name is 3-amino-N-[4-(sulfamoylmethyl)phenyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[4-(sulfamoylmethyl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119701893 |
| Molecular Formula | C11H18ClN3O3S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-amino-N-[4-(sulfamoylmethyl)phenyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)Nc1ccc(CS(N)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C11H17N3O3S.ClH/c1-8(12)6-11(15)14-10-4-2-9(3-5-10)7-18(13,16)17;/h2-5,8H,6-7,12H2,1H3,(H,14,15)(H2,13,16,17);1H |
| InChIKey | YNDMRFYCGQAZNZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |