C15H20N4O2 — CID 82850765
5-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]hexanamide (PubChem CID 82850765) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]hexanamide.
| Compound Name | 5-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 82850765 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]hexanamide |
| SMILES | CC(N)CCCC(=O)Nc1ccc(-c2cc(=O)[nH][nH]2)cc1 |
| InChI | InChI=1S/C15H20N4O2/c1-10(16)3-2-4-14(20)17-12-7-5-11(6-8-12)13-9-15(21)19-18-13/h5-10H,2-4,16H2,1H3,(H,17,20)(H2,18,19,21) |
| InChIKey | BSYYMOHYNGNFPP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |