C13H16N4O2 — CID 43706888
4-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide (PubChem CID 43706888) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide.
| Compound Name | 4-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 43706888 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-amino-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide |
| SMILES | NCCCC(=O)Nc1ccc(-c2cc(=O)[nH][nH]2)cc1 |
| InChI | InChI=1S/C13H16N4O2/c14-7-1-2-12(18)15-10-5-3-9(4-6-10)11-8-13(19)17-16-11/h3-6,8H,1-2,7,14H2,(H,15,18)(H2,16,17,19) |
| InChIKey | RQJPIVYGKYICHK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |