C13H15N3O3 — CID 79201501
4-hydroxy-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide (PubChem CID 79201501) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-hydroxy-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide.
| Compound Name | 4-hydroxy-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 79201501 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-hydroxy-N-[4-(5-oxo-1,2-dihydropyrazol-3-yl)phenyl]butanamide |
| SMILES | O=C(CCCO)Nc1ccc(-c2cc(=O)[nH][nH]2)cc1 |
| InChI | InChI=1S/C13H15N3O3/c17-7-1-2-12(18)14-10-5-3-9(4-6-10)11-8-13(19)16-15-11/h3-6,8,17H,1-2,7H2,(H,14,18)(H2,15,16,19) |
| InChIKey | LHOTYHJKHOCJDR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |