C14H18N2O3 — CID 113420057
3-[4-(prop-2-enylcarbamoylamino)phenyl]butanoic acid (PubChem CID 113420057) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[4-(prop-2-enylcarbamoylamino)phenyl]butanoic acid.
| Compound Name | 3-[4-(prop-2-enylcarbamoylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 113420057 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[4-(prop-2-enylcarbamoylamino)phenyl]butanoic acid |
| SMILES | C=CCNC(=O)Nc1ccc(C(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-3-8-15-14(19)16-12-6-4-11(5-7-12)10(2)9-13(17)18/h3-7,10H,1,8-9H2,2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | YJHODTPOPZJGMU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|