C19H27NO6 — CID 66662832
(3R)-3-[4-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]phenyl]butanoic acid (PubChem CID 66662832) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3R)-3-[4-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]phenyl]butanoic acid.
| Compound Name | (3R)-3-[4-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 66662832 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (3R)-3-[4-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]phenyl]butanoic acid |
| SMILES | CC(C)C(=O)O[C@@H](OC(=O)Nc1ccc([C@H](C)CC(=O)O)cc1)C(C)C |
| InChI | InChI=1S/C19H27NO6/c1-11(2)17(23)25-18(12(3)4)26-19(24)20-15-8-6-14(7-9-15)13(5)10-16(21)22/h6-9,11-13,18H,10H2,1-5H3,(H,20,24)(H,21,22)/t13-,18+/m1/s1 |
| InChIKey | VAAARGTWEUBRPF-ACJLOTCBSA-N |
| XLogP | 3.99 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|