C16H24N2O3 — CID 104503052
3-[4-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]butanoic acid (PubChem CID 104503052) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[4-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]butanoic acid.
| Compound Name | 3-[4-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 104503052 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[4-[[(2R)-2-amino-3,3-dimethylbutanoyl]amino]phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(NC(=O)[C@H](N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-10(9-13(19)20)11-5-7-12(8-6-11)18-15(21)14(17)16(2,3)4/h5-8,10,14H,9,17H2,1-4H3,(H,18,21)(H,19,20)/t10?,14-/m0/s1 |
| InChIKey | MMXCLOXENHIOGO-SBNLOKMTSA-N |
| XLogP | 2.58 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |