C17H27N3O2 — CID 119703637
(2S)-2-amino-3,3-dimethyl-N-[4-(3-methylbutanoylamino)phenyl]butanamide (PubChem CID 119703637) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[4-(3-methylbutanoylamino)phenyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[4-(3-methylbutanoylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 119703637 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[4-(3-methylbutanoylamino)phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)[C@@H](N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-11(2)10-14(21)19-12-6-8-13(9-7-12)20-16(22)15(18)17(3,4)5/h6-9,11,15H,10,18H2,1-5H3,(H,19,21)(H,20,22)/t15-/m1/s1 |
| InChIKey | NXFZQDBAKBSQDM-OAHLLOKOSA-N |
| XLogP | 2.98 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |