C12H18N2O — CID 63090374
3-methyl-N-[4-(methylamino)phenyl]butanamide (PubChem CID 63090374) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-methyl-N-[4-(methylamino)phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-(methylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 63090374 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-methyl-N-[4-(methylamino)phenyl]butanamide |
| SMILES | CNc1ccc(NC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-9(2)8-12(15)14-11-6-4-10(13-3)5-7-11/h4-7,9,13H,8H2,1-3H3,(H,14,15) |
| InChIKey | VADHJOJUASWHCA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |